CAS 16081-93-9 appears in our catalog under these names: 3-Phenyl-2,4(1h,3h)-quinazolinedithione, 95%, 2-Mercapto-3-phenyl-3h-quinazoline-4-thione, 95%, 3-Phenyl-1H-quinazoline-2,4-dithione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
3-phenyl-1H-quinazoline-2,4-dithione (CAS 16081-93-9) is a chemical compound with the molecular formula C14H10N2S2 and a molecular weight of 270.4 g/mol. IUPAC name: 3-phenyl-1H-quinazoline-2,4-dithione. InChIKey: DJJOAJCVIYRELX-UHFFFAOYSA-N.
| Molecular formula | C14H10N2S2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 3-phenyl-1H-quinazoline-2,4-dithione |
| InChIKey | DJJOAJCVIYRELX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=S)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)