CAS 1608116-38-6 is the registry number for 2,4-Dichloro Baquiloprim. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
5-[(2,4-dichloropyrimidin-5-yl)methyl]-N,N,7-trimethylquinolin-8-amine (CAS 1608116-38-6) is a chemical compound with the molecular formula C17H16Cl2N4 and a molecular weight of 347.2 g/mol. IUPAC name: 5-[(2,4-dichloropyrimidin-5-yl)methyl]-N,N,7-trimethylquinolin-8-amine. InChIKey: ICNMKOPWWYAHIW-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2N4 |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 5-[(2,4-dichloropyrimidin-5-yl)methyl]-N,N,7-trimethylquinolin-8-amine |
| InChIKey | ICNMKOPWWYAHIW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC=NC2=C1N(C)C)CC3=CN=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)