CAS 1608125-21-8 appears in our catalog under these names: Amg319, 95%, AMG319, AMG319/ 98.9% (existing batch purity), AMG 319, AMG319 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 25mg, 5mg, 10mg, 50mg, 2mg, 25 mg.
N-[(1S)-1-(7-fluoro-2-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine (CAS 1608125-21-8) is a chemical compound with the molecular formula C21H16FN7 and a molecular weight of 385.4 g/mol. IUPAC name: N-[(1S)-1-(7-fluoro-2-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine. InChIKey: KWRYMZHCQIOOEB-LBPRGKRZSA-N.
| Molecular formula | C21H16FN7 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | N-[(1S)-1-(7-fluoro-2-pyridin-2-ylquinolin-3-yl)ethyl]-7H-purin-6-amine |
| InChIKey | KWRYMZHCQIOOEB-LBPRGKRZSA-N |
| SMILES | C[C@@H](C1=C(N=C2C=C(C=CC2=C1)F)C3=CC=CC=N3)NC4=NC=NC5=C4NC=N5 |
Computed by PubChem (NCBI)