CAS 16083-75-3 is the registry number for 3-(Perfluoro-5-methylhexyl)-2-hydroxypropylacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] prop-2-enoate (CAS 16083-75-3) is a chemical compound with the molecular formula C13H9F15O3 and a molecular weight of 498.18 g/mol. IUPAC name: [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] prop-2-enoate. InChIKey: LEAPLXCRUNAADY-UHFFFAOYSA-N.
| Molecular formula | C13H9F15O3 |
|---|---|
| Molecular weight | 498.18 g/mol |
| IUPAC name | [4,4,5,5,6,6,7,7,8,9,9,9-dodecafluoro-2-hydroxy-8-(trifluoromethyl)nonyl] prop-2-enoate |
| InChIKey | LEAPLXCRUNAADY-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(CC(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)