CAS 16083-79-7 is the registry number for 4,4,5,5,6,7,7,7-Octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl methacrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate (CAS 16083-79-7) is a chemical compound with the molecular formula C12H11F11O3 and a molecular weight of 412.20 g/mol. IUPAC name: [4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate. InChIKey: LZKRGSPBGVICLV-UHFFFAOYSA-N.
| Molecular formula | C12H11F11O3 |
|---|---|
| Molecular weight | 412.20 g/mol |
| IUPAC name | [4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate |
| InChIKey | LZKRGSPBGVICLV-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(CC(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)