CAS 16089-63-7 is the registry number for Methyl[(4-methylphenyl)methylene]ammoniumolate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-methyl-1-(4-methylphenyl)methanimine oxide (CAS 16089-63-7) is a chemical compound with the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. IUPAC name: N-methyl-1-(4-methylphenyl)methanimine oxide. InChIKey: QZJWIZSRELSJQP-YFHOEESVSA-N.
| Molecular formula | C9H11NO |
|---|---|
| Molecular weight | 149.19 g/mol |
| IUPAC name | N-methyl-1-(4-methylphenyl)methanimine oxide |
| InChIKey | QZJWIZSRELSJQP-YFHOEESVSA-N |
| SMILES | CC1=CC=C(C=C1)/C=[N+](/C)\[O-] |
Computed by PubChem (NCBI)