Products 1609087-67-3

CAS 1609087-67-3 is the registry number for 2,6-Di(heptan-4-yl)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2,6-di(heptan-4-yl)aniline (CAS 1609087-67-3) is a chemical compound with the molecular formula C20H35N and a molecular weight of 289.5 g/mol. IUPAC name: 2,6-di(heptan-4-yl)aniline. InChIKey: ZHZWGRBYRGXTRH-UHFFFAOYSA-N.

Identity
Molecular formulaC20H35N
Molecular weight289.5 g/mol
IUPAC name2,6-di(heptan-4-yl)aniline
InChIKeyZHZWGRBYRGXTRH-UHFFFAOYSA-N
SMILESCCCC(CCC)C1=C(C(=CC=C1)C(CCC)CCC)N

Computed by PubChem (NCBI)