Products 1609182-56-0
CAS 1609182-56-0 is the registry number for Geranyl monophosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Azane;[(2Z)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate (CAS 1609182-56-0) is a chemical compound with the molecular formula C10H25N2O4P and a molecular weight of 268.29 g/mol. IUPAC name: azane;[(2Z)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate. InChIKey: AWWVKXBTDOVFSN-QISVCDMNSA-N.
| Molecular formula | C10H25N2O4P |
|---|---|
| Molecular weight | 268.29 g/mol |
| IUPAC name | azane;[(2Z)-3,7-dimethylocta-2,6-dienyl] dihydrogen phosphate |
| InChIKey | AWWVKXBTDOVFSN-QISVCDMNSA-N |
| SMILES | CC(=CCC/C(=C\COP(=O)(O)O)/C)C.N.N |
Computed by PubChem (NCBI)
Synonyms:
Geranyl Monophosphate-DA