Products 1609258-91-4
CAS 1609258-91-4 is the registry number for PF2562. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg, Get quote.
4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]-1H-pyrazolo[4,5-c]pyridine (CAS 1609258-91-4) is a chemical compound with the molecular formula C19H17N5O and a molecular weight of 331.4 g/mol. IUPAC name: 4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]-1H-pyrazolo[4,5-c]pyridine. InChIKey: IDIUJOHYYBNCPC-UHFFFAOYSA-N.
| Molecular formula | C19H17N5O |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | 4-[4-(4,6-dimethylpyrimidin-5-yl)-3-methylphenoxy]-1H-pyrazolo[4,5-c]pyridine |
| InChIKey | IDIUJOHYYBNCPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=NC=CC3=C2C=NN3)C4=C(N=CN=C4C)C |
Computed by PubChem (NCBI)