Products 1609395-82-5

CAS 1609395-82-5 is the registry number for 1-(2,2-Dimethylpropyl)-4-piperidinamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2,2-dimethylpropyl)piperidin-4-amine;hydrochloride (CAS 1609395-82-5) is a chemical compound with the molecular formula C10H23ClN2 and a molecular weight of 206.75 g/mol. IUPAC name: 1-(2,2-dimethylpropyl)piperidin-4-amine;hydrochloride. InChIKey: IOFIFXITISDZTI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H23ClN2
Molecular weight206.75 g/mol
IUPAC name1-(2,2-dimethylpropyl)piperidin-4-amine;hydrochloride
InChIKeyIOFIFXITISDZTI-UHFFFAOYSA-N
SMILESCC(C)(C)CN1CCC(CC1)N.Cl

Computed by PubChem (NCBI)