CAS 1609396-33-9 appears in our catalog under these names: [(5-Cyclopropyl-1h-pyrazol-3-yl)methyl]amine diethanedioate, 95%, (5-Cyclopropyl-1H-pyrazol-3-yl)methanamine dioxalate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(3-cyclopropyl-1H-pyrazol-5-yl)methanamine;oxalic acid (CAS 1609396-33-9) is a chemical compound with the molecular formula C11H15N3O8 and a molecular weight of 317.25 g/mol. IUPAC name: (3-cyclopropyl-1H-pyrazol-5-yl)methanamine;oxalic acid. InChIKey: MELNPRCMUKGVOY-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O8 |
|---|---|
| Molecular weight | 317.25 g/mol |
| IUPAC name | (3-cyclopropyl-1H-pyrazol-5-yl)methanamine;oxalic acid |
| InChIKey | MELNPRCMUKGVOY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NNC(=C2)CN.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)