CAS 1609396-58-8 is the registry number for N-(3-Nitrobenzyl)-3-pentanamine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[(3-nitrophenyl)methyl]pentan-3-amine;hydrobromide (CAS 1609396-58-8) is a chemical compound with the molecular formula C12H19BrN2O2 and a molecular weight of 303.20 g/mol. IUPAC name: N-[(3-nitrophenyl)methyl]pentan-3-amine;hydrobromide. InChIKey: AEWRSDXJONTEAA-UHFFFAOYSA-N.
| Molecular formula | C12H19BrN2O2 |
|---|---|
| Molecular weight | 303.20 g/mol |
| IUPAC name | N-[(3-nitrophenyl)methyl]pentan-3-amine;hydrobromide |
| InChIKey | AEWRSDXJONTEAA-UHFFFAOYSA-N |
| SMILES | CCC(CC)NCC1=CC(=CC=C1)[N+](=O)[O-].Br |
Computed by PubChem (NCBI)