CAS 1609399-89-4 is the registry number for N-[(1-Ethyl-3,5-dimethyl-1h-pyrazol-4-yl)methyl]-2-propanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]propan-2-amine;hydrochloride (CAS 1609399-89-4) is a chemical compound with the molecular formula C11H22ClN3 and a molecular weight of 231.76 g/mol. IUPAC name: N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]propan-2-amine;hydrochloride. InChIKey: NUFPLVVHFXRWJN-UHFFFAOYSA-N.
| Molecular formula | C11H22ClN3 |
|---|---|
| Molecular weight | 231.76 g/mol |
| IUPAC name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]propan-2-amine;hydrochloride |
| InChIKey | NUFPLVVHFXRWJN-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)CNC(C)C)C.Cl |
Computed by PubChem (NCBI)