CAS 1609402-96-1 appears in our catalog under these names: 3,9-Diazaspiro[5.5]undecane-2,4-dione dihydrochloride, 95%, 3,9-Diazaspiro(5.5)undecane-2,4-dione dihydrochloride, 97%, 3,9–diazaspiro(5·5)undecane–2,4–dione dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g.
3,9-diazaspiro[5.5]undecane-2,4-dione;dihydrochloride (CAS 1609402-96-1) is a chemical compound with the molecular formula C9H16Cl2N2O2 and a molecular weight of 255.14 g/mol. IUPAC name: 3,9-diazaspiro[5.5]undecane-2,4-dione;dihydrochloride. InChIKey: PLFAONXWOYKCIW-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2O2 |
|---|---|
| Molecular weight | 255.14 g/mol |
| IUPAC name | 3,9-diazaspiro[5.5]undecane-2,4-dione;dihydrochloride |
| InChIKey | PLFAONXWOYKCIW-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)NC(=O)C2.Cl.Cl |
Computed by PubChem (NCBI)