CAS 1609403-55-5 is the registry number for (1,3-Benzodioxol-5-ylmethyl)(4-chlorobenzyl)amine hydrobromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)methanamine;hydrobromide (CAS 1609403-55-5) is a chemical compound with the molecular formula C15H15BrClNO2 and a molecular weight of 356.64 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)methanamine;hydrobromide. InChIKey: YRKOLPDCFFNWFI-UHFFFAOYSA-N.
| Molecular formula | C15H15BrClNO2 |
|---|---|
| Molecular weight | 356.64 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)methanamine;hydrobromide |
| InChIKey | YRKOLPDCFFNWFI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNCC3=CC=C(C=C3)Cl.Br |
Computed by PubChem (NCBI)