Products 1609406-99-6

CAS 1609406-99-6 is the registry number for 4-Amino-n,4-dimethylpentanamide hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-amino-N,4-dimethylpentanamide;hydrate (CAS 1609406-99-6) is a chemical compound with the molecular formula C7H18N2O2 and a molecular weight of 162.23 g/mol. IUPAC name: 4-amino-N,4-dimethylpentanamide;hydrate. InChIKey: SYGWVYHSOYNGEG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H18N2O2
Molecular weight162.23 g/mol
IUPAC name4-amino-N,4-dimethylpentanamide;hydrate
InChIKeySYGWVYHSOYNGEG-UHFFFAOYSA-N
SMILESCC(C)(CCC(=O)NC)N.O

Computed by PubChem (NCBI)