Products 1609646-56-1

CAS 1609646-56-1 appears in our catalog under these names: 2-Bromo-6-carboxy-1-oxo-1,2-dihydropyridin-1-ium, 95%, 2-Bromo-6-carboxy-1-oxo-1,2-dihydropyridin-1-ium, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid (CAS 1609646-56-1) is a chemical compound with the molecular formula C6H5BrNO3+ and a molecular weight of 219.01 g/mol. IUPAC name: 2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid. InChIKey: IWZAAWIFVRILMQ-UHFFFAOYSA-O.

Identity
Molecular formulaC6H5BrNO3+
Molecular weight219.01 g/mol
IUPAC name2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid
InChIKeyIWZAAWIFVRILMQ-UHFFFAOYSA-O
SMILESC1=CC([N+](=O)C(=C1)C(=O)O)Br

Computed by PubChem (NCBI)