CAS 1609646-56-1 appears in our catalog under these names: 2-Bromo-6-carboxy-1-oxo-1,2-dihydropyridin-1-ium, 95%, 2-Bromo-6-carboxy-1-oxo-1,2-dihydropyridin-1-ium, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid (CAS 1609646-56-1) is a chemical compound with the molecular formula C6H5BrNO3+ and a molecular weight of 219.01 g/mol. IUPAC name: 2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid. InChIKey: IWZAAWIFVRILMQ-UHFFFAOYSA-O.
| Molecular formula | C6H5BrNO3+ |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 2-bromo-1-oxo-2H-pyridin-1-ium-6-carboxylic acid |
| InChIKey | IWZAAWIFVRILMQ-UHFFFAOYSA-O |
| SMILES | C1=CC([N+](=O)C(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)