CAS 160989-35-5 is the registry number for 3,4–Dibromo–1–trityl–1H–pyrrole–2,5–dione. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 5g.
3,4-dibromo-1-tritylpyrrole-2,5-dione (CAS 160989-35-5) is a chemical compound with the molecular formula C23H15Br2NO2 and a molecular weight of 497.2 g/mol. IUPAC name: 3,4-dibromo-1-tritylpyrrole-2,5-dione. InChIKey: FGDKRGOBBHAODC-UHFFFAOYSA-N.
| Molecular formula | C23H15Br2NO2 |
|---|---|
| Molecular weight | 497.2 g/mol |
| IUPAC name | 3,4-dibromo-1-tritylpyrrole-2,5-dione |
| InChIKey | FGDKRGOBBHAODC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C(=O)C(=C(C4=O)Br)Br |
Computed by PubChem (NCBI)