CAS 1610036-44-6 appears in our catalog under these names: O1-tert-butyl O2-methyl (2R,4S)-4-benzyloxypyrrolidine-1,2-dicarboxylate, 97%, 97%, 1-TERT-BUTYL 2-METHYL (2R,4S)-4-(BENZYLOXY)PYRROLIDINE-1,2-DICARBOXYLATE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 2-O-methyl (2R,4S)-4-phenylmethoxypyrrolidine-1,2-dicarboxylate (CAS 1610036-44-6) is a chemical compound with the molecular formula C18H25NO5 and a molecular weight of 335.4 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4S)-4-phenylmethoxypyrrolidine-1,2-dicarboxylate. InChIKey: AXXKODYHGLJTHX-LSDHHAIUSA-N.
| Molecular formula | C18H25NO5 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-phenylmethoxypyrrolidine-1,2-dicarboxylate |
| InChIKey | AXXKODYHGLJTHX-LSDHHAIUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)OC)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)