CAS 161006-22-0 is the registry number for 6-[(tert-butyldimethylsilyl)oxy]naphthalen-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-ol (CAS 161006-22-0) is a chemical compound with the molecular formula C16H22O2Si and a molecular weight of 274.43 g/mol. IUPAC name: 6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-ol. InChIKey: WKVIQWGMANSRSM-UHFFFAOYSA-N.
| Molecular formula | C16H22O2Si |
|---|---|
| Molecular weight | 274.43 g/mol |
| IUPAC name | 6-[tert-butyl(dimethyl)silyl]oxynaphthalen-2-ol |
| InChIKey | WKVIQWGMANSRSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)