CAS 161014-56-8 is the registry number for Keto Tiagabine Tosylate. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(3S)-1-[4,4-bis(3-methylthiophen-2-yl)-3-oxobutyl]piperidine-3-carboxylic acid;4-methylbenzenesulfonic acid (CAS 161014-56-8) is a chemical compound with the molecular formula C27H33NO6S3 and a molecular weight of 563.8 g/mol. IUPAC name: (3S)-1-[4,4-bis(3-methylthiophen-2-yl)-3-oxobutyl]piperidine-3-carboxylic acid;4-methylbenzenesulfonic acid. InChIKey: PXDIWSZORHMNBU-RSAXXLAASA-N.
| Molecular formula | C27H33NO6S3 |
|---|---|
| Molecular weight | 563.8 g/mol |
| IUPAC name | (3S)-1-[4,4-bis(3-methylthiophen-2-yl)-3-oxobutyl]piperidine-3-carboxylic acid;4-methylbenzenesulfonic acid |
| InChIKey | PXDIWSZORHMNBU-RSAXXLAASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=C(SC=C1)C(C2=C(C=CS2)C)C(=O)CCN3CCC[C@@H](C3)C(=O)O |
Computed by PubChem (NCBI)