CAS 16104-50-0 is the registry number for 1,3-dichloroadamantane. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dichloroadamantane (CAS 16104-50-0) is a chemical compound with the molecular formula C10H14Cl2 and a molecular weight of 205.12 g/mol. IUPAC name: 1,3-dichloroadamantane. InChIKey: DZLCQHWJVJXVES-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2 |
|---|---|
| Molecular weight | 205.12 g/mol |
| IUPAC name | 1,3-dichloroadamantane |
| InChIKey | DZLCQHWJVJXVES-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Cl)Cl |
Computed by PubChem (NCBI)