Products 161042-41-7
CAS 161042-41-7 is the registry number for 2-Deschloro Carfentrazone Ethyl Ester. Offered by: TRC. Available pack sizes: 25mg.
Ethyl 3-[2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl]propanoate (CAS 161042-41-7) is a chemical compound with the molecular formula C15H15ClF3N3O3 and a molecular weight of 377.74 g/mol. IUPAC name: ethyl 3-[2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl]propanoate. InChIKey: FMSBECMBLPOLKJ-UHFFFAOYSA-N.
| Molecular formula | C15H15ClF3N3O3 |
|---|---|
| Molecular weight | 377.74 g/mol |
| IUPAC name | ethyl 3-[2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl]propanoate |
| InChIKey | FMSBECMBLPOLKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC(=C(C=C1Cl)F)N2C(=O)N(C(=N2)C)C(F)F |
Computed by PubChem (NCBI)