CAS 1610526-17-4 is the registry number for 2-((2,4-Dioxo-6-(((2S,3S,4R)-2,3,4,5-tetrahydroxypentyl)amino)-1,2,3,4-tetrahydropyrimidin-5-yl)imino)acetaldehyde. Offered by: TRC. Available pack sizes: 10mg.
5-(2-oxoethylideneamino)-6-D-ribitylaminouracil is an aminouracil that is D-ribitol in which the hydroxy group at position 1 is substituted by the 6-amino group of 6-amino-5-(2-oxoethylideneamino)uracil. Unstable mucosal-associated invariant T (MAIT)-activating antigen, formed by non-enzymatic reaction between 5-amino-6-D-ribitylaminouracil and glyoxal. It has a role as an antigen.
Source: ChEBI
| Molecular formula | C11H16N4O7 |
|---|---|
| Molecular weight | 316.27 g/mol |
| IUPAC name | 2-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]imino]acetaldehyde |
| InChIKey | PUEQUELBQOQOOV-BBVRLYRLSA-N |
| SMILES | C([C@@H]([C@@H]([C@@H](CO)O)O)O)NC1=C(C(=O)NC(=O)N1)N=CC=O |
Computed by PubChem (NCBI)