CAS 1610536-69-0 appears in our catalog under these names: JNJ–47117096 hydrochloride (MELK–T1 hydrochloride), Jnj-47117096 hydrochloride, JNJ-47117096 HCl 98%, JNJ-47117096 hydrochloride, 98.01%, 98.01%, JNJ-47117096 hydrochloride, 99.68%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 250mg, 10 mg.
2-methoxy-4-(1H-pyrazol-4-yl)-N-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)benzamide;hydrochloride (CAS 1610536-69-0) is a chemical compound with the molecular formula C21H23ClN4O2 and a molecular weight of 398.9 g/mol. IUPAC name: 2-methoxy-4-(1H-pyrazol-4-yl)-N-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)benzamide;hydrochloride. InChIKey: OXRWZUUCCUDKJJ-UHFFFAOYSA-N.
| Molecular formula | C21H23ClN4O2 |
|---|---|
| Molecular weight | 398.9 g/mol |
| IUPAC name | 2-methoxy-4-(1H-pyrazol-4-yl)-N-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)benzamide;hydrochloride |
| InChIKey | OXRWZUUCCUDKJJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CNN=C2)C(=O)NC3=CC4=C(CCNCC4)C=C3.Cl |
Computed by PubChem (NCBI)