CAS 1610550-64-5 is the registry number for (E)-2-((2-Chloro-5-nitrobenzylidene)amino)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]isoindole-1,3-dione (CAS 1610550-64-5) is a chemical compound with the molecular formula C15H8ClN3O4 and a molecular weight of 329.69 g/mol. IUPAC name: 2-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]isoindole-1,3-dione. InChIKey: HKKAJYQKDOSXKD-CAOOACKPSA-N.
| Molecular formula | C15H8ClN3O4 |
|---|---|
| Molecular weight | 329.69 g/mol |
| IUPAC name | 2-[(E)-(2-chloro-5-nitrophenyl)methylideneamino]isoindole-1,3-dione |
| InChIKey | HKKAJYQKDOSXKD-CAOOACKPSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)/N=C/C3=C(C=CC(=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)