Products 1610733-43-1
CAS 1610733-43-1 is the registry number for (4-(4-Methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]boronic acid (CAS 1610733-43-1) is a chemical compound with the molecular formula C12H16BF3N2O2 and a molecular weight of 288.08 g/mol. IUPAC name: [4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: MJUHGYMTHJDGPD-UHFFFAOYSA-N.
| Molecular formula | C12H16BF3N2O2 |
|---|---|
| Molecular weight | 288.08 g/mol |
| IUPAC name | [4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MJUHGYMTHJDGPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N2CCN(CC2)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)