CAS 1610878-54-0 appears in our catalog under these names: Telomerase-IN-2, 98%, Telomerase-IN-2/ 99.32% (existing batch purity), Telomerase–IN–2, Telomerase-in-2, Telomerase-IN-2, 99.79%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100 mg.
5,7-dimethoxy-3-[4-[4-(pyridine-4-carbonyl)piperazin-1-yl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one (CAS 1610878-54-0) is a chemical compound with the molecular formula C34H39N3O9 and a molecular weight of 633.7 g/mol. IUPAC name: 5,7-dimethoxy-3-[4-[4-(pyridine-4-carbonyl)piperazin-1-yl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: HDOUAPSDPPFIGT-UHFFFAOYSA-N.
| Molecular formula | C34H39N3O9 |
|---|---|
| Molecular weight | 633.7 g/mol |
| IUPAC name | 5,7-dimethoxy-3-[4-[4-(pyridine-4-carbonyl)piperazin-1-yl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | HDOUAPSDPPFIGT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=C(O2)C3=CC(=C(C(=C3)OC)OC)OC)OCCCCN4CCN(CC4)C(=O)C5=CC=NC=C5 |
Computed by PubChem (NCBI)