CAS 1610980-30-7 is the registry number for Dapoxetine Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1,3-dichloropropyl]benzene (CAS 1610980-30-7) is a chemical compound with the molecular formula C9H10Cl2 and a molecular weight of 189.08 g/mol. IUPAC name: [(1R)-1,3-dichloropropyl]benzene. InChIKey: PGGFEXFACFLDGE-SECBINFHSA-N.
| Molecular formula | C9H10Cl2 |
|---|---|
| Molecular weight | 189.08 g/mol |
| IUPAC name | [(1R)-1,3-dichloropropyl]benzene |
| InChIKey | PGGFEXFACFLDGE-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCCl)Cl |
Computed by PubChem (NCBI)