CAS 16116-80-6 appears in our catalog under these names: 4-[(Trimethylsilyl)ethynyl]benzoic acid, 95%, 4-((TRIMETHYLSILYL)ETHYNYL)BENZOIC ACID, 4-[(Trimethylsilyl)ethynyl]benzoic Acid. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg.
4-(2-trimethylsilylethynyl)benzoic acid (CAS 16116-80-6) is a chemical compound with the molecular formula C12H14O2Si and a molecular weight of 218.32 g/mol. IUPAC name: 4-(2-trimethylsilylethynyl)benzoic acid. InChIKey: GUFYYXWHDBOLBG-UHFFFAOYSA-N.
| Molecular formula | C12H14O2Si |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(2-trimethylsilylethynyl)benzoic acid |
| InChIKey | GUFYYXWHDBOLBG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)