CAS 1612148-85-2 is the registry number for 5-(2,6-Dimethoxyphenyl)-1-(4-fluorophenyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid (CAS 1612148-85-2) is a chemical compound with the molecular formula C18H15FN2O4 and a molecular weight of 342.3 g/mol. IUPAC name: 5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid. InChIKey: YXZZFYTZKLINTK-UHFFFAOYSA-N.
| Molecular formula | C18H15FN2O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | YXZZFYTZKLINTK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C2=CC(=NN2C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)