CAS 1612156-14-5 is the registry number for tert-Butyl 5-(1-(tert-butoxycarbonyl)piperidin-4-yl)-1H-indole-1- carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
Tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-1-carboxylate (CAS 1612156-14-5) is a chemical compound with the molecular formula C23H32N2O4 and a molecular weight of 400.5 g/mol. IUPAC name: tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-1-carboxylate. InChIKey: AECNVGUDTCJEFM-UHFFFAOYSA-N.
| Molecular formula | C23H32N2O4 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | tert-butyl 5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-1-carboxylate |
| InChIKey | AECNVGUDTCJEFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC3=C(C=C2)N(C=C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)