CAS 1612176-06-3 is the registry number for (3R,4S)-1-(4-Aminopyrimidin-2-yl)-3-fluoro-4-methylpiperidin-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-(4-aminopyrimidin-2-yl)-3-fluoro-4-methylpiperidin-4-ol (CAS 1612176-06-3) is a chemical compound with the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. IUPAC name: (3R,4S)-1-(4-aminopyrimidin-2-yl)-3-fluoro-4-methylpiperidin-4-ol. InChIKey: QLXITVJFXUHSOE-XCBNKYQSSA-N.
| Molecular formula | C10H15FN4O |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | (3R,4S)-1-(4-aminopyrimidin-2-yl)-3-fluoro-4-methylpiperidin-4-ol |
| InChIKey | QLXITVJFXUHSOE-XCBNKYQSSA-N |
| SMILES | C[C@@]1(CCN(C[C@H]1F)C2=NC=CC(=N2)N)O |
Computed by PubChem (NCBI)