CAS 1612192-28-5 is the registry number for 1,2-Di-O-acetyl-3-deoxy-3-fluoro-5-O-(4-methyl)benzoyl-D-ribofuranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl 4-methylbenzoate (CAS 1612192-28-5) is a chemical compound with the molecular formula C17H19FO7 and a molecular weight of 354.3 g/mol. IUPAC name: [(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl 4-methylbenzoate. InChIKey: SYXLNQJSHVLYRK-BOEXNKMNSA-N.
| Molecular formula | C17H19FO7 |
|---|---|
| Molecular weight | 354.3 g/mol |
| IUPAC name | [(2R,3R,4S)-4,5-diacetyloxy-3-fluorooxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | SYXLNQJSHVLYRK-BOEXNKMNSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@H](C(O2)OC(=O)C)OC(=O)C)F |
Computed by PubChem (NCBI)