Products 1612216-47-3

CAS 1612216-47-3 is the registry number for 4-Methoxyphenyl 2-iodo-3-methylbutanoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.

(4-methoxyphenyl) 2-iodo-3-methylbutanoate (CAS 1612216-47-3) is a chemical compound with the molecular formula C12H15IO3 and a molecular weight of 334.15 g/mol. IUPAC name: (4-methoxyphenyl) 2-iodo-3-methylbutanoate. InChIKey: ZIBJSARKWRYTSW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15IO3
Molecular weight334.15 g/mol
IUPAC name(4-methoxyphenyl) 2-iodo-3-methylbutanoate
InChIKeyZIBJSARKWRYTSW-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)OC1=CC=C(C=C1)OC)I

Computed by PubChem (NCBI)