Products 161229-62-5
CAS 161229-62-5 is the registry number for ZM260384. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-bis(difluoromethyl)-6-nitro-4-(1-oxido-2H-pyridin-6-yl)-3H-1,4-benzoxazine (CAS 161229-62-5) is a chemical compound with the molecular formula C15H12F4N3O4- and a molecular weight of 374.27 g/mol. IUPAC name: 2,2-bis(difluoromethyl)-6-nitro-4-(1-oxido-2H-pyridin-6-yl)-3H-1,4-benzoxazine. InChIKey: RNHICCNROBDFRJ-UHFFFAOYSA-N.
| Molecular formula | C15H12F4N3O4- |
|---|---|
| Molecular weight | 374.27 g/mol |
| IUPAC name | 2,2-bis(difluoromethyl)-6-nitro-4-(1-oxido-2H-pyridin-6-yl)-3H-1,4-benzoxazine |
| InChIKey | RNHICCNROBDFRJ-UHFFFAOYSA-N |
| SMILES | C1C=CC=C(N1[O-])N2CC(OC3=C2C=C(C=C3)[N+](=O)[O-])(C(F)F)C(F)F |
Computed by PubChem (NCBI)