CAS 16127-59-6 is the registry number for Calcium (R)-2-hydroxypropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Calcium bis((2R)-2-hydroxypropanoate) (CAS 16127-59-6) is a chemical compound with the molecular formula C6H10CaO6 and a molecular weight of 218.22 g/mol. IUPAC name: calcium bis((2R)-2-hydroxypropanoate). InChIKey: MKJXYGKVIBWPFZ-JCWNAWFTSA-L.
| Molecular formula | C6H10CaO6 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | calcium bis((2R)-2-hydroxypropanoate) |
| InChIKey | MKJXYGKVIBWPFZ-JCWNAWFTSA-L |
| SMILES | C[C@H](C(=O)[O-])O.C[C@H](C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)