CAS 1612756-29-2 appears in our catalog under these names: NAI 1, NAI–N3, NAI-N3, 99.93%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 10mg, 5mg, 50mg, 5 mg, 10 mg, 25 mg, 100 mg.
[2-(azidomethyl)-3-pyridinyl]-imidazol-1-ylmethanone (CAS 1612756-29-2) is a chemical compound with the molecular formula C10H8N6O and a molecular weight of 228.21 g/mol. IUPAC name: [2-(azidomethyl)-3-pyridinyl]-imidazol-1-ylmethanone. InChIKey: QPSQVTFTPHUCEH-UHFFFAOYSA-N.
| Molecular formula | C10H8N6O |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | [2-(azidomethyl)-3-pyridinyl]-imidazol-1-ylmethanone |
| InChIKey | QPSQVTFTPHUCEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)CN=[N+]=[N-])C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)