Products 1612827-44-7
CAS 1612827-44-7 is the registry number for 5-(4-Fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine (CAS 1612827-44-7) is a chemical compound with the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. IUPAC name: 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine. InChIKey: CBIIZVCYDZUMHD-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO2 |
|---|---|
| Molecular weight | 225.26 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine |
| InChIKey | CBIIZVCYDZUMHD-UHFFFAOYSA-N |
| SMILES | CC1(OCC(CO1)(C2=CC=C(C=C2)F)N)C |
Computed by PubChem (NCBI)