CAS 161287-08-7 is the registry number for Efinaconazole Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-2-(2,4-difluorophenyl)-3-hydroxy-1-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate (CAS 161287-08-7) is a chemical compound with the molecular formula C13H15F2N3O4S and a molecular weight of 347.34 g/mol. IUPAC name: [(2R,3R)-2-(2,4-difluorophenyl)-3-hydroxy-1-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate. InChIKey: BMTLQGBGYXSMJN-NOZJJQNGSA-N.
| Molecular formula | C13H15F2N3O4S |
|---|---|
| Molecular weight | 347.34 g/mol |
| IUPAC name | [(2R,3R)-2-(2,4-difluorophenyl)-3-hydroxy-1-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate |
| InChIKey | BMTLQGBGYXSMJN-NOZJJQNGSA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)OS(=O)(=O)C)O |
Computed by PubChem (NCBI)