CAS 1613-66-7 appears in our catalog under these names: Diphenylgermanium dichloride, 98%, Diphenyldichlorogermane, Diphenyldichlorogermane, >95.0%(GC). Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 5g, 1g, on request, 10g.
Dichloro(diphenyl)germane (CAS 1613-66-7) is a chemical compound with the molecular formula C12H10Cl2Ge and a molecular weight of 297.7 g/mol. IUPAC name: dichloro(diphenyl)germane. InChIKey: PFPTYRFVUHDUIN-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2Ge |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | dichloro(diphenyl)germane |
| InChIKey | PFPTYRFVUHDUIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(Cl)Cl |
Computed by PubChem (NCBI)