CAS 16130-76-0 appears in our catalog under these names: calcium terephthalate, 1,4-Benzenedicarboxylic acid, calcium salt (1:x), 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100g.
Calcium terephthalate (CAS 16130-76-0) is a chemical compound with the molecular formula C8H4CaO4 and a molecular weight of 204.19 g/mol. IUPAC name: calcium terephthalate. InChIKey: AAEHPKIXIIACPQ-UHFFFAOYSA-L.
| Molecular formula | C8H4CaO4 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | calcium terephthalate |
| InChIKey | AAEHPKIXIIACPQ-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)