CAS 161314-17-6 appears in our catalog under these names: NNGH, MMP-3 Inhibitor II, NNGH 99%, MMP-3 Inhibitor II 1PC X 5MG, N-Hydroxy-2-((N-isobutyl-4-methoxyphenyl)sulfonamido)acetamide, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 500mg, 1mg, 25mg, 5mg, 10mg, 50mg, 100mg, 250mg.
N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]acetamide (CAS 161314-17-6) is a chemical compound with the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. IUPAC name: N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]acetamide. InChIKey: JIRXORZYIXSWOB-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O5S |
|---|---|
| Molecular weight | 316.38 g/mol |
| IUPAC name | N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]acetamide |
| InChIKey | JIRXORZYIXSWOB-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(=O)NO)S(=O)(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)