Products 1613233-35-4
CAS 1613233-35-4 is the registry number for 3-(Dimethylphenylsilyl)propyl 2-propenoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[dimethyl(phenyl)silyl]propyl prop-2-enoate (CAS 1613233-35-4) is a chemical compound with the molecular formula C14H20O2Si and a molecular weight of 248.39 g/mol. IUPAC name: 3-[dimethyl(phenyl)silyl]propyl prop-2-enoate. InChIKey: VVWGVAXHYWYQNC-UHFFFAOYSA-N.
| Molecular formula | C14H20O2Si |
|---|---|
| Molecular weight | 248.39 g/mol |
| IUPAC name | 3-[dimethyl(phenyl)silyl]propyl prop-2-enoate |
| InChIKey | VVWGVAXHYWYQNC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCOC(=O)C=C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)