Products 2377032-15-8

CAS 2377032-15-8 is the registry number for 1,1-Dimethyl-4-phenylsilinane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,1-dimethyl-4-phenylsilinane-4-carboxylic acid (CAS 2377032-15-8) is a chemical compound with the molecular formula C14H20O2Si and a molecular weight of 248.39 g/mol. IUPAC name: 1,1-dimethyl-4-phenylsilinane-4-carboxylic acid. InChIKey: GSPSHBRCNMIIHM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O2Si
Molecular weight248.39 g/mol
IUPAC name1,1-dimethyl-4-phenylsilinane-4-carboxylic acid
InChIKeyGSPSHBRCNMIIHM-UHFFFAOYSA-N
SMILESC[Si]1(CCC(CC1)(C2=CC=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)