CAS 2377032-15-8 is the registry number for 1,1-Dimethyl-4-phenylsilinane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dimethyl-4-phenylsilinane-4-carboxylic acid (CAS 2377032-15-8) is a chemical compound with the molecular formula C14H20O2Si and a molecular weight of 248.39 g/mol. IUPAC name: 1,1-dimethyl-4-phenylsilinane-4-carboxylic acid. InChIKey: GSPSHBRCNMIIHM-UHFFFAOYSA-N.
| Molecular formula | C14H20O2Si |
|---|---|
| Molecular weight | 248.39 g/mol |
| IUPAC name | 1,1-dimethyl-4-phenylsilinane-4-carboxylic acid |
| InChIKey | GSPSHBRCNMIIHM-UHFFFAOYSA-N |
| SMILES | C[Si]1(CCC(CC1)(C2=CC=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)