CAS 1613264-40-6 appears in our catalog under these names: BAY-1316957, 98+%, BAY–1316957, BAY 1316957, BAY-1316957, 99.73%, BAY-1316957, 98.94%. Offered by: AmBeed, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 100 mg, 10 mg.
2-(9-ethyl-6-methylcarbazol-3-yl)-1-(2-methoxyethyl)-4-methylbenzimidazole-5-carboxylic acid (CAS 1613264-40-6) is a chemical compound with the molecular formula C27H27N3O3 and a molecular weight of 441.5 g/mol. IUPAC name: 2-(9-ethyl-6-methylcarbazol-3-yl)-1-(2-methoxyethyl)-4-methylbenzimidazole-5-carboxylic acid. InChIKey: FHXIZAPGGULPIK-UHFFFAOYSA-N.
| Molecular formula | C27H27N3O3 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 2-(9-ethyl-6-methylcarbazol-3-yl)-1-(2-methoxyethyl)-4-methylbenzimidazole-5-carboxylic acid |
| InChIKey | FHXIZAPGGULPIK-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C)C3=C1C=CC(=C3)C4=NC5=C(N4CCOC)C=CC(=C5C)C(=O)O |
Computed by PubChem (NCBI)