CAS 1613264-89-3 is the registry number for Benzofuran-d6. Offered by: TRC. Available pack sizes: 100mg.
2,3,4,5,6,7-hexadeuterio-1-benzofuran (CAS 1613264-89-3) is a chemical compound with the molecular formula C8H6O and a molecular weight of 124.17 g/mol. IUPAC name: 2,3,4,5,6,7-hexadeuterio-1-benzofuran. InChIKey: IANQTJSKSUMEQM-MZWXYZOWSA-N.
| Molecular formula | C8H6O |
|---|---|
| Molecular weight | 124.17 g/mol |
| IUPAC name | 2,3,4,5,6,7-hexadeuterio-1-benzofuran |
| InChIKey | IANQTJSKSUMEQM-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(O2)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)