CAS 1613292-56-0 is the registry number for 3-(tert-Butoxycarbonyl)thiazolidine-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid (CAS 1613292-56-0) is a chemical compound with the molecular formula C9H15NO6S and a molecular weight of 265.29 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid. InChIKey: DMGYOOQFRVLAJC-UHFFFAOYSA-N.
| Molecular formula | C9H15NO6S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | DMGYOOQFRVLAJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CS(=O)(=O)CC1C(=O)O |
Computed by PubChem (NCBI)