CAS 1613292-57-1 is the registry number for tert-Butyl 4-carbamoylthiazolidine-3-carboxylate 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-carbamoyl-1,1-dioxo-1,3-thiazolidine-3-carboxylate (CAS 1613292-57-1) is a chemical compound with the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. IUPAC name: tert-butyl 4-carbamoyl-1,1-dioxo-1,3-thiazolidine-3-carboxylate. InChIKey: ZKDKISGKOBYMEO-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O5S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | tert-butyl 4-carbamoyl-1,1-dioxo-1,3-thiazolidine-3-carboxylate |
| InChIKey | ZKDKISGKOBYMEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CS(=O)(=O)CC1C(=O)N |
Computed by PubChem (NCBI)