CAS 1613439-62-5 appears in our catalog under these names: PF–05274857 (hydrochloride), PF-5274857 hydrochloride, PF 5274857 hydrochloride, PF-5274857 HCl 98%, PF-05274857 HCl, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 50mg, 1mg, 10mg, 25mg, 100mg, 250mg, Get quote.
1-[4-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperazin-1-yl]-3-methylsulfonylpropan-1-one;hydrochloride (CAS 1613439-62-5) is a chemical compound with the molecular formula C20H26Cl2N4O3S and a molecular weight of 473.4 g/mol. IUPAC name: 1-[4-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperazin-1-yl]-3-methylsulfonylpropan-1-one;hydrochloride. InChIKey: GULNFUQAVPTTQV-UHFFFAOYSA-N.
| Molecular formula | C20H26Cl2N4O3S |
|---|---|
| Molecular weight | 473.4 g/mol |
| IUPAC name | 1-[4-[5-chloro-4-(3,5-dimethyl-2-pyridinyl)-2-pyridinyl]piperazin-1-yl]-3-methylsulfonylpropan-1-one;hydrochloride |
| InChIKey | GULNFUQAVPTTQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)C2=CC(=NC=C2Cl)N3CCN(CC3)C(=O)CCS(=O)(=O)C)C.Cl |
Computed by PubChem (NCBI)